C21H27N5O3 — CID 51999642
5-(cyclopentanecarbonylamino)-1-methyl-N-(4-morpholin-4-ylphenyl)pyrazole-3-carboxamide (PubChem CID 51999642) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-1-methyl-N-(4-morpholin-4-ylphenyl)pyrazole-3-carboxamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-1-methyl-N-(4-morpholin-4-ylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999642 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-1-methyl-N-(4-morpholin-4-ylphenyl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(N3CCOCC3)cc2)cc1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C21H27N5O3/c1-25-19(23-20(27)15-4-2-3-5-15)14-18(24-25)21(28)22-16-6-8-17(9-7-16)26-10-12-29-13-11-26/h6-9,14-15H,2-5,10-13H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | RUHMEFUFQJBTDW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|