C16H24N4O2S — CID 51999688
5-(cyclopentanecarbonylamino)-1-methyl-N-(thian-4-yl)pyrazole-3-carboxamide (PubChem CID 51999688) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-(cyclopentanecarbonylamino)-1-methyl-N-(thian-4-yl)pyrazole-3-carboxamide.
| Compound Name | 5-(cyclopentanecarbonylamino)-1-methyl-N-(thian-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999688 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-(cyclopentanecarbonylamino)-1-methyl-N-(thian-4-yl)pyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NC2CCSCC2)cc1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C16H24N4O2S/c1-20-14(18-15(21)11-4-2-3-5-11)10-13(19-20)16(22)17-12-6-8-23-9-7-12/h10-12H,2-9H2,1H3,(H,17,22)(H,18,21) |
| InChIKey | ABLVGVCUQSARFH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |