C20H15BrFNO6S — CID 5200642
2-[2-bromo-4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 5200642) has the molecular formula C20H15BrFNO6S and a molecular weight of 496.31 g/mol. Its IUPAC name is 2-[2-bromo-4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 5200642 |
| Molecular Formula | C20H15BrFNO6S |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 2-[2-bromo-4-[[3-[(2-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C=C2SC(=O)N(Cc3ccccc3F)C2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C20H15BrFNO6S/c1-28-15-7-11(6-13(21)18(15)29-10-17(24)25)8-16-19(26)23(20(27)30-16)9-12-4-2-3-5-14(12)22/h2-8H,9-10H2,1H3,(H,24,25) |
| InChIKey | URRLUFKJUATMHM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|