About 1,4-diphenoxybenzene
1,4-diphenoxybenzene (PubChem CID 520487) has the molecular formula C18H14O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1,4-diphenoxybenzene.
Molecular Properties
| Compound Name | 1,4-diphenoxybenzene |
| PubChem CID | 520487 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1,4-diphenoxybenzene |
| SMILES | c1ccc(Oc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H |
| InChIKey | UVGPELGZPWDPFP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diphenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenoxybenzene?
The IUPAC name of 1,4-diphenoxybenzene (CID 520487) is 1,4-diphenoxybenzene.
What is the SMILES notation for 1,4-diphenoxybenzene?
The canonical SMILES for 1,4-diphenoxybenzene is c1ccc(Oc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of 1,4-diphenoxybenzene?
The InChIKey is UVGPELGZPWDPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H.
What are the key properties of 1,4-diphenoxybenzene?
1,4-diphenoxybenzene has a molecular weight of 262.31 g/mol, XLogP of 5.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenoxybenzene is sourced from PubChem (CID 520487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).