C24H17FN2O3S2 — CID 5211506
1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione (PubChem CID 5211506) has the molecular formula C24H17FN2O3S2 and a molecular weight of 464.54 g/mol. Its IUPAC name is 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5211506 |
| Molecular Formula | C24H17FN2O3S2 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-(thiophene-2-carbonyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(=O)C(C(=O)c4cccs4)C3c3ccccc3F)sc2c1 |
| InChI | InChI=1S/C24H17FN2O3S2/c1-12-10-13(2)19-17(11-12)32-24(26-19)27-20(14-6-3-4-7-15(14)25)18(22(29)23(27)30)21(28)16-8-5-9-31-16/h3-11,18,20H,1-2H3 |
| InChIKey | LXOWJPRGIAXCGQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|