C25H20F3NO3 — CID 5215498
3-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1-methylindol-2-one (PubChem CID 5215498) has the molecular formula C25H20F3NO3 and a molecular weight of 439.43 g/mol. Its IUPAC name is 3-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1-methylindol-2-one.
| Compound Name | 3-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 5215498 |
| Molecular Formula | C25H20F3NO3 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylidene]-1-methylindol-2-one |
| SMILES | COc1cc(C=C2C(=O)N(C)c3ccccc32)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H20F3NO3/c1-29-21-9-4-3-8-19(21)20(24(29)30)13-16-10-11-22(23(14-16)31-2)32-15-17-6-5-7-18(12-17)25(26,27)28/h3-14H,15H2,1-2H3 |
| InChIKey | OYRMZWPVWSFDAN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|