C26H20F3NO2 — CID 6184265
2-[(E)-2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethenyl]quinoline (PubChem CID 6184265) has the molecular formula C26H20F3NO2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 2-[(E)-2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethenyl]quinoline.
| Compound Name | 2-[(E)-2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethenyl]quinoline |
|---|---|
| PubChem CID | 6184265 |
| Molecular Formula | C26H20F3NO2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[(E)-2-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]ethenyl]quinoline |
| SMILES | COc1cc(/C=C/c2ccc3ccccc3n2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H20F3NO2/c1-31-25-16-18(9-12-22-13-11-20-6-2-3-8-23(20)30-22)10-14-24(25)32-17-19-5-4-7-21(15-19)26(27,28)29/h2-16H,17H2,1H3/b12-9+ |
| InChIKey | AKJCMMPMHOOELS-FMIVXFBMSA-N |
| XLogP | 7.01 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |