C23H16Cl2N2O2S — CID 5218469
3-(3,5-dichloro-2-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 5218469) has the molecular formula C23H16Cl2N2O2S and a molecular weight of 455.37 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 5218469 |
| Molecular Formula | C23H16Cl2N2O2S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C23H16Cl2N2O2S/c1-29-22-17(11-18(24)12-19(22)25)8-9-21(28)27-23-26-20(13-30-23)16-7-6-14-4-2-3-5-15(14)10-16/h2-13H,1H3,(H,26,27,28) |
| InChIKey | ZKPXDJRLZFVCIJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|