C24H20N2O4S — CID 5222922
ethyl 3-[[4-hydroxy-3-methyl-5-[(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-ylidene]amino]benzoate (PubChem CID 5222922) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is ethyl 3-[[4-hydroxy-3-methyl-5-[(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-ylidene]amino]benzoate.
| Compound Name | ethyl 3-[[4-hydroxy-3-methyl-5-[(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 5222922 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | ethyl 3-[[4-hydroxy-3-methyl-5-[(2-oxonaphthalen-1-ylidene)methyl]-1,3-thiazol-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(/N=c2/sc(C=C3C(=O)C=Cc4ccccc43)c(O)n2C)c1 |
| InChI | InChI=1S/C24H20N2O4S/c1-3-30-23(29)16-8-6-9-17(13-16)25-24-26(2)22(28)21(31-24)14-19-18-10-5-4-7-15(18)11-12-20(19)27/h4-14,28H,3H2,1-2H3/b19-14?,25-24+ |
| InChIKey | MEAPQSUGLDWPOZ-KRIXBPQJSA-N |
| XLogP | 4.34 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|