C17H35NO2Si3 — CID 522303
2-[3,4-bis(trimethylsilyloxy)phenyl]-N-trimethylsilylethanamine (PubChem CID 522303) has the molecular formula C17H35NO2Si3 and a molecular weight of 369.73 g/mol. Its IUPAC name is 2-[3,4-bis(trimethylsilyloxy)phenyl]-N-trimethylsilylethanamine.
| Compound Name | 2-[3,4-bis(trimethylsilyloxy)phenyl]-N-trimethylsilylethanamine |
|---|---|
| PubChem CID | 522303 |
| Molecular Formula | C17H35NO2Si3 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-[3,4-bis(trimethylsilyloxy)phenyl]-N-trimethylsilylethanamine |
| SMILES | C[Si](C)(C)NCCc1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C17H35NO2Si3/c1-21(2,3)18-13-12-15-10-11-16(19-22(4,5)6)17(14-15)20-23(7,8)9/h10-11,14,18H,12-13H2,1-9H3 |
| InChIKey | IDQRGLQSFWNZMQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|