C26H33N5O5S2 — CID 5227226
N-[3-[5-[2-[4-(diethylsulfamoyl)phenyl]-2-oxoethyl]sulfanyl-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5227226) has the molecular formula C26H33N5O5S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[3-[5-[2-[4-(diethylsulfamoyl)phenyl]-2-oxoethyl]sulfanyl-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[5-[2-[4-(diethylsulfamoyl)phenyl]-2-oxoethyl]sulfanyl-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5227226 |
| Molecular Formula | C26H33N5O5S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-[3-[5-[2-[4-(diethylsulfamoyl)phenyl]-2-oxoethyl]sulfanyl-4-(3-methoxyphenyl)-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)CSc2nnc(CCCNC(C)=O)n2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C26H33N5O5S2/c1-5-30(6-2)38(34,35)23-14-12-20(13-15-23)24(33)18-37-26-29-28-25(11-8-16-27-19(3)32)31(26)21-9-7-10-22(17-21)36-4/h7,9-10,12-15,17H,5-6,8,11,16,18H2,1-4H3,(H,27,32) |
| InChIKey | UUCNEBJMSZHWSO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|