C13H18 — CID 523103
3,3,5,7-tetramethyl-1,2-dihydroindene (PubChem CID 523103) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 3,3,5,7-tetramethyl-1,2-dihydroindene.
| Compound Name | 3,3,5,7-tetramethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 523103 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 3,3,5,7-tetramethyl-1,2-dihydroindene |
| SMILES | Cc1cc(C)c2c(c1)C(C)(C)CC2 |
| InChI | InChI=1S/C13H18/c1-9-7-10(2)11-5-6-13(3,4)12(11)8-9/h7-8H,5-6H2,1-4H3 |
| InChIKey | PJPNYZCIGFQVQG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |