C11H6ClF3N4S — CID 5231060
6-(4-chlorophenyl)-3-(trifluoromethyl)-7H-[1,2,4]thiadiazolo[4,5-b][1,2,4]triazine (PubChem CID 5231060) has the molecular formula C11H6ClF3N4S and a molecular weight of 318.71 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(trifluoromethyl)-7H-[1,2,4]thiadiazolo[4,5-b][1,2,4]triazine.
| Compound Name | 6-(4-chlorophenyl)-3-(trifluoromethyl)-7H-[1,2,4]thiadiazolo[4,5-b][1,2,4]triazine |
|---|---|
| PubChem CID | 5231060 |
| Molecular Formula | C11H6ClF3N4S |
| Molecular Weight | 318.71 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(trifluoromethyl)-7H-[1,2,4]thiadiazolo[4,5-b][1,2,4]triazine |
| SMILES | FC(F)(F)C1=NSC2=NCC(c3ccc(Cl)cc3)=NN21 |
| InChI | InChI=1S/C11H6ClF3N4S/c12-7-3-1-6(2-4-7)8-5-16-10-19(17-8)9(18-20-10)11(13,14)15/h1-4H,5H2 |
| InChIKey | QFGYVPRICSOJDN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|