C18H12ClF3N6S — CID 156597757
6-(4-chlorophenyl)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-amine (PubChem CID 156597757) has the molecular formula C18H12ClF3N6S and a molecular weight of 436.85 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-amine.
| Compound Name | 6-(4-chlorophenyl)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-amine |
|---|---|
| PubChem CID | 156597757 |
| Molecular Formula | C18H12ClF3N6S |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-amine |
| SMILES | FC(F)(F)c1ccc(/C=N/Nc2nnc3n2N=C(c2ccc(Cl)cc2)CS3)cc1 |
| InChI | InChI=1S/C18H12ClF3N6S/c19-14-7-3-12(4-8-14)15-10-29-17-26-25-16(28(17)27-15)24-23-9-11-1-5-13(6-2-11)18(20,21)22/h1-9H,10H2,(H,24,25)/b23-9+ |
| InChIKey | LZYBFQAZKJGJLL-NUGSKGIGSA-N |
| XLogP | 4.75 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|