C10H14O3S2 — CID 5231827
3-(1-oxo-1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 5231827) has the molecular formula C10H14O3S2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-(1-oxo-1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | 3-(1-oxo-1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 5231827 |
| Molecular Formula | C10H14O3S2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(1-oxo-1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | O=S1CCCSC1C1=CC=CC(O)C1O |
| InChI | InChI=1S/C10H14O3S2/c11-8-4-1-3-7(9(8)12)10-14-5-2-6-15(10)13/h1,3-4,8-12H,2,5-6H2 |
| InChIKey | ZVFLIVVQLUWHOC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |