C17H18N2S2 — CID 5231860
2-[3,3-bis(methylsulfanyl)-1-(2-propan-2-ylphenyl)prop-2-enylidene]propanedinitrile (PubChem CID 5231860) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 2-[3,3-bis(methylsulfanyl)-1-(2-propan-2-ylphenyl)prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[3,3-bis(methylsulfanyl)-1-(2-propan-2-ylphenyl)prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 5231860 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[3,3-bis(methylsulfanyl)-1-(2-propan-2-ylphenyl)prop-2-enylidene]propanedinitrile |
| SMILES | CSC(=CC(=C(C#N)C#N)c1ccccc1C(C)C)SC |
| InChI | InChI=1S/C17H18N2S2/c1-12(2)14-7-5-6-8-15(14)16(13(10-18)11-19)9-17(20-3)21-4/h5-9,12H,1-4H3 |
| InChIKey | IUTADGKYXNURKN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|