C18H44O5Si4 — CID 523345
trimethylsilyl 2,5,6-tris(trimethylsilyloxy)hexanoate (PubChem CID 523345) has the molecular formula C18H44O5Si4 and a molecular weight of 452.89 g/mol. Its IUPAC name is trimethylsilyl 2,5,6-tris(trimethylsilyloxy)hexanoate.
| Compound Name | trimethylsilyl 2,5,6-tris(trimethylsilyloxy)hexanoate |
|---|---|
| PubChem CID | 523345 |
| Molecular Formula | C18H44O5Si4 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | trimethylsilyl 2,5,6-tris(trimethylsilyloxy)hexanoate |
| SMILES | C[Si](C)(C)OCC(CCC(O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H44O5Si4/c1-24(2,3)20-15-16(21-25(4,5)6)13-14-17(22-26(7,8)9)18(19)23-27(10,11)12/h16-17H,13-15H2,1-12H3 |
| InChIKey | RTVJXDVRXIFDGR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|