C21H22N4O4 — CID 5235571
N-(2-methyl-4-nitrophenyl)-N'-(4-phenylbut-3-en-2-ylideneamino)butanediamide (PubChem CID 5235571) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-N'-(4-phenylbut-3-en-2-ylideneamino)butanediamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-N'-(4-phenylbut-3-en-2-ylideneamino)butanediamide |
|---|---|
| PubChem CID | 5235571 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-N'-(4-phenylbut-3-en-2-ylideneamino)butanediamide |
| SMILES | CC(C=Cc1ccccc1)=NNC(=O)CCC(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C21H22N4O4/c1-15-14-18(25(28)29)10-11-19(15)22-20(26)12-13-21(27)24-23-16(2)8-9-17-6-4-3-5-7-17/h3-11,14H,12-13H2,1-2H3,(H,22,26)(H,24,27) |
| InChIKey | QTHLLAHIELNVIA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|