C25H26F3N3O4S — CID 5237078
ethyl 4-[[2-[3-butyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate (PubChem CID 5237078) has the molecular formula C25H26F3N3O4S and a molecular weight of 521.56 g/mol. Its IUPAC name is ethyl 4-[[2-[3-butyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-butyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 5237078 |
| Molecular Formula | C25H26F3N3O4S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | ethyl 4-[[2-[3-butyl-4-oxo-2-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-5-yl]acetyl]amino]benzoate |
| SMILES | CCCCN1C(=O)C(CC(=O)Nc2ccc(C(=O)OCC)cc2)S/C1=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26F3N3O4S/c1-3-5-13-31-22(33)20(36-24(31)30-19-8-6-7-17(14-19)25(26,27)28)15-21(32)29-18-11-9-16(10-12-18)23(34)35-4-2/h6-12,14,20H,3-5,13,15H2,1-2H3,(H,29,32)/b30-24- |
| InChIKey | LRTMYLRYZRXDPZ-KRUMMXJUSA-N |
| XLogP | 5.64 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|