C26H27N3OS2 — CID 5243664
2-(1-adamantyl)-N-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide (PubChem CID 5243664) has the molecular formula C26H27N3OS2 and a molecular weight of 461.66 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 5243664 |
| Molecular Formula | C26H27N3OS2 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-(1-adamantyl)-N-[(4-naphthalen-1-yl-1,3-thiazol-2-yl)carbamothioyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NC(=S)Nc1nc(-c2cccc3ccccc23)cs1 |
| InChI | InChI=1S/C26H27N3OS2/c30-23(14-26-11-16-8-17(12-26)10-18(9-16)13-26)28-24(31)29-25-27-22(15-32-25)21-7-3-5-19-4-1-2-6-20(19)21/h1-7,15-18H,8-14H2,(H2,27,28,29,30,31) |
| InChIKey | DXDAOAYEUZYGBC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|