C15H21N3O3 — CID 5247243
1,4,7-tris(prop-2-enyl)-1,4,7-triazonane-2,5,8-trione (PubChem CID 5247243) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1,4,7-tris(prop-2-enyl)-1,4,7-triazonane-2,5,8-trione.
| Compound Name | 1,4,7-tris(prop-2-enyl)-1,4,7-triazonane-2,5,8-trione |
|---|---|
| PubChem CID | 5247243 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1,4,7-tris(prop-2-enyl)-1,4,7-triazonane-2,5,8-trione |
| SMILES | C=CCN1CC(=O)N(CC=C)CC(=O)N(CC=C)CC1=O |
| InChI | InChI=1S/C15H21N3O3/c1-4-7-16-10-14(20)18(9-6-3)12-15(21)17(8-5-2)11-13(16)19/h4-6H,1-3,7-12H2 |
| InChIKey | NRZJKSYNKUZUOO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|