C10H16N2O — CID 67895247
1,4-bis(prop-2-enyl)piperazin-2-one (PubChem CID 67895247) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,4-bis(prop-2-enyl)piperazin-2-one.
| Compound Name | 1,4-bis(prop-2-enyl)piperazin-2-one |
|---|---|
| PubChem CID | 67895247 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1,4-bis(prop-2-enyl)piperazin-2-one |
| SMILES | C=CCN1CCN(CC=C)C(=O)C1 |
| InChI | InChI=1S/C10H16N2O/c1-3-5-11-7-8-12(6-4-2)10(13)9-11/h3-4H,1-2,5-9H2 |
| InChIKey | MFQGJLDXOONIQW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|