C24H36N4S — CID 5247925
4-[3,4,5-tri(piperidin-4-yl)thiophen-2-yl]-1,2-dihydropyridine (PubChem CID 5247925) has the molecular formula C24H36N4S and a molecular weight of 412.65 g/mol. Its IUPAC name is 4-[3,4,5-tri(piperidin-4-yl)thiophen-2-yl]-1,2-dihydropyridine.
| Compound Name | 4-[3,4,5-tri(piperidin-4-yl)thiophen-2-yl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 5247925 |
| Molecular Formula | C24H36N4S |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 4-[3,4,5-tri(piperidin-4-yl)thiophen-2-yl]-1,2-dihydropyridine |
| SMILES | C1=CC(c2sc(C3CCNCC3)c(C3CCNCC3)c2C2CCNCC2)=CCN1 |
| InChI | InChI=1S/C24H36N4S/c1-9-25-10-2-17(1)21-22(18-3-11-26-12-4-18)24(20-7-15-28-16-8-20)29-23(21)19-5-13-27-14-6-19/h5-6,13,17-18,20,25-28H,1-4,7-12,14-16H2 |
| InChIKey | PSBOGCIEWWEDDZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |