C16H12N2O7 — CID 5249346
dimethyl 5-nitro-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate (PubChem CID 5249346) has the molecular formula C16H12N2O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is dimethyl 5-nitro-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate.
| Compound Name | dimethyl 5-nitro-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 5249346 |
| Molecular Formula | C16H12N2O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | dimethyl 5-nitro-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)NC(=O)c2cc([N+](=O)[O-])c3ccccc3c21 |
| InChI | InChI=1S/C16H12N2O7/c1-24-14(20)16(15(21)25-2)12-9-6-4-3-5-8(9)11(18(22)23)7-10(12)13(19)17-16/h3-7H,1-2H3,(H,17,19) |
| InChIKey | XIOINJOKTOMDEI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|