C16H14N2O5 — CID 10615142
dimethyl 5-amino-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate (PubChem CID 10615142) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is dimethyl 5-amino-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate.
| Compound Name | dimethyl 5-amino-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10615142 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | dimethyl 5-amino-3-oxo-2H-benzo[g]isoindole-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)NC(=O)c2cc(N)c3ccccc3c21 |
| InChI | InChI=1S/C16H14N2O5/c1-22-14(20)16(15(21)23-2)12-9-6-4-3-5-8(9)11(17)7-10(12)13(19)18-16/h3-7H,17H2,1-2H3,(H,18,19) |
| InChIKey | XKXJYVHRIAZZHN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|