C12H10N2O7 — CID 125471614
dimethyl 6-nitro-3-oxo-2H-isoindole-1,1-dicarboxylate (PubChem CID 125471614) has the molecular formula C12H10N2O7 and a molecular weight of 294.22 g/mol. Its IUPAC name is dimethyl 6-nitro-3-oxo-2H-isoindole-1,1-dicarboxylate.
| Compound Name | dimethyl 6-nitro-3-oxo-2H-isoindole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 125471614 |
| Molecular Formula | C12H10N2O7 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | dimethyl 6-nitro-3-oxo-2H-isoindole-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)NC(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H10N2O7/c1-20-10(16)12(11(17)21-2)8-5-6(14(18)19)3-4-7(8)9(15)13-12/h3-5H,1-2H3,(H,13,15) |
| InChIKey | OXTDWXUZBJCMDT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|