C16H20N2O7 — CID 122394680
dimethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]propanedioate (PubChem CID 122394680) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is dimethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]propanedioate.
| Compound Name | dimethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]propanedioate |
|---|---|
| PubChem CID | 122394680 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | dimethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H20N2O7/c1-16(2,3)17-13(19)10-7-6-9(18(22)23)8-11(10)12(14(20)24-4)15(21)25-5/h6-8,12H,1-5H3,(H,17,19) |
| InChIKey | AYKQPDKLVQLIBA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|