C21H20N2O5 — CID 53275933
ethyl 2-[(4-nitrophenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate (PubChem CID 53275933) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 2-[(4-nitrophenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate.
| Compound Name | ethyl 2-[(4-nitrophenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate |
|---|---|
| PubChem CID | 53275933 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl 2-[(4-nitrophenyl)methyl]-3-oxo-1-prop-2-enylisoindole-1-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)c2ccccc2C(=O)N1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N2O5/c1-3-13-21(20(25)28-4-2)18-8-6-5-7-17(18)19(24)22(21)14-15-9-11-16(12-10-15)23(26)27/h3,5-12H,1,4,13-14H2,2H3 |
| InChIKey | LIWUQIAEDONQBN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|