C22H20N2O8 — CID 163875137
diethyl 2-benzyl-2-(5-nitro-1,3-dioxoisoindol-2-yl)propanedioate (PubChem CID 163875137) has the molecular formula C22H20N2O8 and a molecular weight of 440.41 g/mol. Its IUPAC name is diethyl 2-benzyl-2-(5-nitro-1,3-dioxoisoindol-2-yl)propanedioate.
| Compound Name | diethyl 2-benzyl-2-(5-nitro-1,3-dioxoisoindol-2-yl)propanedioate |
|---|---|
| PubChem CID | 163875137 |
| Molecular Formula | C22H20N2O8 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | diethyl 2-benzyl-2-(5-nitro-1,3-dioxoisoindol-2-yl)propanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(C(=O)OCC)N1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C22H20N2O8/c1-3-31-20(27)22(21(28)32-4-2,13-14-8-6-5-7-9-14)23-18(25)16-11-10-15(24(29)30)12-17(16)19(23)26/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | POFOCZFESFKQRS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|