C16H21N3O4S — CID 52509170
ethyl 3-[[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]sulfamoyl]benzoate (PubChem CID 52509170) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is ethyl 3-[[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]sulfamoyl]benzoate.
| Compound Name | ethyl 3-[[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 52509170 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | ethyl 3-[[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1cccc(S(=O)(=O)N[C@H](C)c2cnn(C)c2C)c1 |
| InChI | InChI=1S/C16H21N3O4S/c1-5-23-16(20)13-7-6-8-14(9-13)24(21,22)18-11(2)15-10-17-19(4)12(15)3/h6-11,18H,5H2,1-4H3/t11-/m1/s1 |
| InChIKey | VZJQOSWARSIWAB-LLVKDONJSA-N |
| XLogP | 1.94 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |