C40H44O4Si2 — CID 5251016
4,4,7,7,11,11,14,14-octamethyl-2,2,9,9-tetraphenyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne (PubChem CID 5251016) has the molecular formula C40H44O4Si2 and a molecular weight of 644.96 g/mol. Its IUPAC name is 4,4,7,7,11,11,14,14-octamethyl-2,2,9,9-tetraphenyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne.
| Compound Name | 4,4,7,7,11,11,14,14-octamethyl-2,2,9,9-tetraphenyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne |
|---|---|
| PubChem CID | 5251016 |
| Molecular Formula | C40H44O4Si2 |
| Molecular Weight | 644.96 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 4,4,7,7,11,11,14,14-octamethyl-2,2,9,9-tetraphenyl-1,3,8,10-tetraoxa-2,9-disilacyclotetradeca-5,12-diyne |
| SMILES | CC1(C)C#CC(C)(C)O[Si](c2ccccc2)(c2ccccc2)OC(C)(C)C#CC(C)(C)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C40H44O4Si2/c1-37(2)29-30-38(3,4)43-46(35-25-17-11-18-26-35,36-27-19-12-20-28-36)44-40(7,8)32-31-39(5,6)42-45(41-37,33-21-13-9-14-22-33)34-23-15-10-16-24-34/h9-28H,1-8H3 |
| InChIKey | RJSZHSWISZYKCF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|