C10H14Br4N2Re-2 — CID 5251027
6-piperidin-1-id-2-yl-2H-pyridin-1-ide;tetrabromorhenium (PubChem CID 5251027) has the molecular formula C10H14Br4N2Re-2 and a molecular weight of 668.06 g/mol. Its IUPAC name is 6-piperidin-1-id-2-yl-2H-pyridin-1-ide;tetrabromorhenium.
| Compound Name | 6-piperidin-1-id-2-yl-2H-pyridin-1-ide;tetrabromorhenium |
|---|---|
| PubChem CID | 5251027 |
| Molecular Formula | C10H14Br4N2Re-2 |
| Molecular Weight | 668.06 g/mol |
| Exact Mass | 664.75 |
| IUPAC Name | 6-piperidin-1-id-2-yl-2H-pyridin-1-ide;tetrabromorhenium |
| SMILES | Br[Re](Br)(Br)Br.C1=CC[N-]C(C2CCCC[N-]2)=C1 |
| InChI | InChI=1S/C10H14N2.4BrH.Re/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;;/h1,3,5,10H,2,4,6-8H2;4*1H;/q-2;;;;;+4/p-4 |
| InChIKey | CXOLPSZYFYPGBS-UHFFFAOYSA-J |
| XLogP | 6.12 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.06 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |