C19H31CuN5-3 — CID 5257754
copper(1+);N-(3,6-dihydro-2H-pyridin-1-id-2-ylmethyl)-1-piperidin-1-id-2-yl-N-(piperidin-1-id-2-ylmethyl)methanamine;cyanide (PubChem CID 5257754) has the molecular formula C19H31CuN5-3 and a molecular weight of 393.04 g/mol. Its IUPAC name is copper(1+);N-(3,6-dihydro-2H-pyridin-1-id-2-ylmethyl)-1-piperidin-1-id-2-yl-N-(piperidin-1-id-2-ylmethyl)methanamine;cyanide.
| Compound Name | copper(1+);N-(3,6-dihydro-2H-pyridin-1-id-2-ylmethyl)-1-piperidin-1-id-2-yl-N-(piperidin-1-id-2-ylmethyl)methanamine;cyanide |
|---|---|
| PubChem CID | 5257754 |
| Molecular Formula | C19H31CuN5-3 |
| Molecular Weight | 393.04 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | copper(1+);N-(3,6-dihydro-2H-pyridin-1-id-2-ylmethyl)-1-piperidin-1-id-2-yl-N-(piperidin-1-id-2-ylmethyl)methanamine;cyanide |
| SMILES | C1=CCC(CN(CC2CCCC[N-]2)CC2CCCC[N-]2)[N-]C1.[C-]#N.[Cu+] |
| InChI | InChI=1S/C18H31N4.CN.Cu/c1-4-10-19-16(7-1)13-22(14-17-8-2-5-11-20-17)15-18-9-3-6-12-21-18;1-2;/h1,4,16-18H,2-3,5-15H2;;/q-3;-1;+1 |
| InChIKey | BLZOAXSIMPNULK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|