C17H29HgN3O-2 — CID 5254858
3,6-dihydro-2H-pyridin-1-id-2-yl-di(piperidin-1-id-2-yl)methanol;methylmercury(1+) (PubChem CID 5254858) has the molecular formula C17H29HgN3O-2 and a molecular weight of 492.03 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-id-2-yl-di(piperidin-1-id-2-yl)methanol;methylmercury(1+).
| Compound Name | 3,6-dihydro-2H-pyridin-1-id-2-yl-di(piperidin-1-id-2-yl)methanol;methylmercury(1+) |
|---|---|
| PubChem CID | 5254858 |
| Molecular Formula | C17H29HgN3O-2 |
| Molecular Weight | 492.03 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-id-2-yl-di(piperidin-1-id-2-yl)methanol;methylmercury(1+) |
| SMILES | C[Hg+].OC(C1CC=CC[N-]1)(C1CCCC[N-]1)C1CCCC[N-]1 |
| InChI | InChI=1S/C16H26N3O.CH3.Hg/c20-16(13-7-1-4-10-17-13,14-8-2-5-11-18-14)15-9-3-6-12-19-15;;/h1,4,13-15,20H,2-3,5-12H2;1H3;/q-3;;+1 |
| InChIKey | VJWVPNYWJORFEJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|