C16H22ClN3O3S — CID 52510426
2-chloro-N-methyl-5-[[(2S)-4-methylsulfanyl-2-(propanoylamino)butanoyl]amino]benzamide (PubChem CID 52510426) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 2-chloro-N-methyl-5-[[(2S)-4-methylsulfanyl-2-(propanoylamino)butanoyl]amino]benzamide.
| Compound Name | 2-chloro-N-methyl-5-[[(2S)-4-methylsulfanyl-2-(propanoylamino)butanoyl]amino]benzamide |
|---|---|
| PubChem CID | 52510426 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-chloro-N-methyl-5-[[(2S)-4-methylsulfanyl-2-(propanoylamino)butanoyl]amino]benzamide |
| SMILES | CCC(=O)N[C@@H](CCSC)C(=O)Nc1ccc(Cl)c(C(=O)NC)c1 |
| InChI | InChI=1S/C16H22ClN3O3S/c1-4-14(21)20-13(7-8-24-3)16(23)19-10-5-6-12(17)11(9-10)15(22)18-2/h5-6,9,13H,4,7-8H2,1-3H3,(H,18,22)(H,19,23)(H,20,21)/t13-/m0/s1 |
| InChIKey | RIJSXEHCVOHSDG-ZDUSSCGKSA-N |
| XLogP | 2.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |