C16H19FN2O4S — CID 52515979
(Z)-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-3-(4-fluorophenyl)but-2-enamide (PubChem CID 52515979) has the molecular formula C16H19FN2O4S and a molecular weight of 354.40 g/mol. Its IUPAC name is (Z)-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-3-(4-fluorophenyl)but-2-enamide.
| Compound Name | (Z)-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-3-(4-fluorophenyl)but-2-enamide |
|---|---|
| PubChem CID | 52515979 |
| Molecular Formula | C16H19FN2O4S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (Z)-N-[2-[[(3S)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-3-(4-fluorophenyl)but-2-enamide |
| SMILES | C/C(=C/C(=O)NCC(=O)N[C@H]1CCS(=O)(=O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2O4S/c1-11(12-2-4-13(17)5-3-12)8-15(20)18-9-16(21)19-14-6-7-24(22,23)10-14/h2-5,8,14H,6-7,9-10H2,1H3,(H,18,20)(H,19,21)/b11-8-/t14-/m0/s1 |
| InChIKey | JMVMRPUNJHHTQV-MSKHEQNASA-N |
| XLogP | 0.65 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|