C22H29N3O3S — CID 52519884
(4R)-N-tert-butyl-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 52519884) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is (4R)-N-tert-butyl-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-tert-butyl-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 52519884 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (4R)-N-tert-butyl-3-[1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | COc1cccc(-n2c(C)cc(C(=O)N3CSC[C@H]3C(=O)NC(C)(C)C)c2C)c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-14-10-18(15(2)25(14)16-8-7-9-17(11-16)28-6)21(27)24-13-29-12-19(24)20(26)23-22(3,4)5/h7-11,19H,12-13H2,1-6H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | ZASYUBGRIMDLBV-IBGZPJMESA-N |
| XLogP | 3.53 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|