C18H20N6O3S2 — CID 52522282
2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]acetamide (PubChem CID 52522282) has the molecular formula C18H20N6O3S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 52522282 |
| Molecular Formula | C18H20N6O3S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-[[5-(2,3-dimethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[5-[(2R)-oxolan-2-yl]-1,3,4-oxadiazol-2-yl]acetamide |
| SMILES | Cc1cccc(Nc2nnc(SCC(=O)Nc3nnc([C@H]4CCCO4)o3)s2)c1C |
| InChI | InChI=1S/C18H20N6O3S2/c1-10-5-3-6-12(11(10)2)19-17-23-24-18(29-17)28-9-14(25)20-16-22-21-15(27-16)13-7-4-8-26-13/h3,5-6,13H,4,7-9H2,1-2H3,(H,19,23)(H,20,22,25)/t13-/m1/s1 |
| InChIKey | NUDRWWMOTBSLBY-CYBMUJFWSA-N |
| XLogP | 3.86 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |