C20H27N3O2S — CID 52524654
N-[(2S)-3-methyl-1-[3-(N-methylanilino)propylamino]-1-oxobutan-2-yl]thiophene-2-carboxamide (PubChem CID 52524654) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-[3-(N-methylanilino)propylamino]-1-oxobutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-3-methyl-1-[3-(N-methylanilino)propylamino]-1-oxobutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 52524654 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[(2S)-3-methyl-1-[3-(N-methylanilino)propylamino]-1-oxobutan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O2S/c1-15(2)18(22-19(24)17-11-7-14-26-17)20(25)21-12-8-13-23(3)16-9-5-4-6-10-16/h4-7,9-11,14-15,18H,8,12-13H2,1-3H3,(H,21,25)(H,22,24)/t18-/m0/s1 |
| InChIKey | NXWKUHZJEXLWNT-SFHVURJKSA-N |
| XLogP | 3.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|