C26H28N4O2S — CID 24543500
N-[(2S)-3-(1H-indol-3-yl)-1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 24543500) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[(2S)-3-(1H-indol-3-yl)-1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-3-(1H-indol-3-yl)-1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24543500 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[(2S)-3-(1H-indol-3-yl)-1-[3-(N-methylanilino)propylamino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CN(CCCNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O2S/c1-30(20-9-3-2-4-10-20)15-8-14-27-25(31)23(29-26(32)24-13-7-16-33-24)17-19-18-28-22-12-6-5-11-21(19)22/h2-7,9-13,16,18,23,28H,8,14-15,17H2,1H3,(H,27,31)(H,29,32)/t23-/m0/s1 |
| InChIKey | LNUYRXNDISJPNN-QHCPKHFHSA-N |
| XLogP | 4.21 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|