C17H18N4O3S — CID 52531647
N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-(5-nitroindol-1-yl)acetamide (PubChem CID 52531647) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-(5-nitroindol-1-yl)acetamide.
| Compound Name | N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-(5-nitroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 52531647 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-(5-nitroindol-1-yl)acetamide |
| SMILES | Cc1nc(C)c([C@@H](C)NC(=O)Cn2ccc3cc([N+](=O)[O-])ccc32)s1 |
| InChI | InChI=1S/C17H18N4O3S/c1-10-17(25-12(3)18-10)11(2)19-16(22)9-20-7-6-13-8-14(21(23)24)4-5-15(13)20/h4-8,11H,9H2,1-3H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | RZDYAOYWTHHUQV-LLVKDONJSA-N |
| XLogP | 3.50 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|