C17H22N4O4 — CID 94820065
(2R)-N-tert-butyl-2-[[2-(5-nitroindol-1-yl)acetyl]amino]propanamide (PubChem CID 94820065) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[[2-(5-nitroindol-1-yl)acetyl]amino]propanamide.
| Compound Name | (2R)-N-tert-butyl-2-[[2-(5-nitroindol-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 94820065 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2R)-N-tert-butyl-2-[[2-(5-nitroindol-1-yl)acetyl]amino]propanamide |
| SMILES | C[C@@H](NC(=O)Cn1ccc2cc([N+](=O)[O-])ccc21)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H22N4O4/c1-11(16(23)19-17(2,3)4)18-15(22)10-20-8-7-12-9-13(21(24)25)5-6-14(12)20/h5-9,11H,10H2,1-4H3,(H,18,22)(H,19,23)/t11-/m1/s1 |
| InChIKey | JLHJLCNQUDKGBE-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|