C17H20N4O6S — CID 56533075
N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]-2-(5-nitroindol-1-yl)acetamide (PubChem CID 56533075) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]-2-(5-nitroindol-1-yl)acetamide.
| Compound Name | N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]-2-(5-nitroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 56533075 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]-2-(5-nitroindol-1-yl)acetamide |
| SMILES | CC(NC(=O)Cn1ccc2cc([N+](=O)[O-])ccc21)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H20N4O6S/c1-12(17(23)19-6-8-28(26,27)9-7-19)18-16(22)11-20-5-4-13-10-14(21(24)25)2-3-15(13)20/h2-5,10,12H,6-9,11H2,1H3,(H,18,22) |
| InChIKey | NBGHXRQWNLWMSE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|