C16H14BrClN2O3S — CID 52533599
(5R)-3-[(3-bromo-4-methoxyphenyl)methyl]-5-(5-chlorothiophen-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 52533599) has the molecular formula C16H14BrClN2O3S and a molecular weight of 429.72 g/mol. Its IUPAC name is (5R)-3-[(3-bromo-4-methoxyphenyl)methyl]-5-(5-chlorothiophen-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(3-bromo-4-methoxyphenyl)methyl]-5-(5-chlorothiophen-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52533599 |
| Molecular Formula | C16H14BrClN2O3S |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | (5R)-3-[(3-bromo-4-methoxyphenyl)methyl]-5-(5-chlorothiophen-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N[C@@](C)(c3ccc(Cl)s3)C2=O)cc1Br |
| InChI | InChI=1S/C16H14BrClN2O3S/c1-16(12-5-6-13(18)24-12)14(21)20(15(22)19-16)8-9-3-4-11(23-2)10(17)7-9/h3-7H,8H2,1-2H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | FTZOKUHFJKAYMU-INIZCTEOSA-N |
| XLogP | 4.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|