C12H15F2N5O — CID 5253595
2-(difluoromethyl)-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylpyrazole-3-carboxamide (PubChem CID 5253595) has the molecular formula C12H15F2N5O and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylpyrazole-3-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5253595 |
| Molecular Formula | C12H15F2N5O |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(difluoromethyl)-N-[(2-ethylpyrazol-3-yl)methyl]-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1nccc1CN(C)C(=O)c1ccnn1C(F)F |
| InChI | InChI=1S/C12H15F2N5O/c1-3-18-9(4-6-15-18)8-17(2)11(20)10-5-7-16-19(10)12(13)14/h4-7,12H,3,8H2,1-2H3 |
| InChIKey | PQXMTFSWUGEPQW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |