C22H30N2O3 — CID 52537917
(2R)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]propan-1-one (PubChem CID 52537917) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2R)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]propan-1-one.
| Compound Name | (2R)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]propan-1-one |
|---|---|
| PubChem CID | 52537917 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (2R)-1-[4-(2-methyl-1H-indol-3-yl)piperidin-1-yl]-2-[[(2R)-oxolan-2-yl]methoxy]propan-1-one |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(C(=O)[C@@H](C)OC[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C22H30N2O3/c1-15-21(19-7-3-4-8-20(19)23-15)17-9-11-24(12-10-17)22(25)16(2)27-14-18-6-5-13-26-18/h3-4,7-8,16-18,23H,5-6,9-14H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | RHKQMPZRFSCMHH-SJLPKXTDSA-N |
| XLogP | 3.77 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|