C16H19N3O4 — CID 52539957
(2S)-1-(2,6-dimethylphenoxy)-3-[(5-nitro-2-pyridinyl)amino]propan-2-ol (PubChem CID 52539957) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2S)-1-(2,6-dimethylphenoxy)-3-[(5-nitro-2-pyridinyl)amino]propan-2-ol.
| Compound Name | (2S)-1-(2,6-dimethylphenoxy)-3-[(5-nitro-2-pyridinyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 52539957 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (2S)-1-(2,6-dimethylphenoxy)-3-[(5-nitro-2-pyridinyl)amino]propan-2-ol |
| SMILES | Cc1cccc(C)c1OC[C@@H](O)CNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H19N3O4/c1-11-4-3-5-12(2)16(11)23-10-14(20)9-18-15-7-6-13(8-17-15)19(21)22/h3-8,14,20H,9-10H2,1-2H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | BJIYOVFICFBUIP-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|