C20H26N2O3 — CID 57064426
N-[1-(2,6-dimethylphenoxy)propan-2-yl]-2-(4-nitrophenyl)propan-1-amine (PubChem CID 57064426) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[1-(2,6-dimethylphenoxy)propan-2-yl]-2-(4-nitrophenyl)propan-1-amine.
| Compound Name | N-[1-(2,6-dimethylphenoxy)propan-2-yl]-2-(4-nitrophenyl)propan-1-amine |
|---|---|
| PubChem CID | 57064426 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[1-(2,6-dimethylphenoxy)propan-2-yl]-2-(4-nitrophenyl)propan-1-amine |
| SMILES | Cc1cccc(C)c1OCC(C)NCC(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-14-6-5-7-15(2)20(14)25-13-17(4)21-12-16(3)18-8-10-19(11-9-18)22(23)24/h5-11,16-17,21H,12-13H2,1-4H3 |
| InChIKey | HGMSXYYQQFZFEM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|