C17H20N2O5S — CID 69379381
N-[2-(2,6-dimethylphenoxy)propyl]-4-nitrobenzenesulfonamide (PubChem CID 69379381) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)propyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)propyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 69379381 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)propyl]-4-nitrobenzenesulfonamide |
| SMILES | Cc1cccc(C)c1OC(C)CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-12-5-4-6-13(2)17(12)24-14(3)11-18-25(22,23)16-9-7-15(8-10-16)19(20)21/h4-10,14,18H,11H2,1-3H3 |
| InChIKey | OTAUWPWXRKAYSI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|