C23H18N4O3S — CID 52541636
2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)-N-methylacetamide (PubChem CID 52541636) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)-N-methylacetamide.
| Compound Name | 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 52541636 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(furan-2-ylmethyl)-N-methylacetamide |
| SMILES | CN(Cc1ccco1)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H18N4O3S/c1-26(14-18-5-4-12-30-18)21(28)15-31-23-25-20-7-3-2-6-19(20)22(29)27(23)17-10-8-16(13-24)9-11-17/h2-12H,14-15H2,1H3 |
| InChIKey | JSBNIERSTRRVIS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |